CAS 103855-82-9 is the registry number for 2-Amino-3-(2,3-dimethylphenyl)propanoic acid, 97%. Offered by: AmBeed. Available pack sizes: 5g.
2-amino-3-(2,3-dimethylphenyl)propanoic acid (CAS 103855-82-9) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: 2-amino-3-(2,3-dimethylphenyl)propanoic acid. InChIKey: YOOQLMVNYYJZEI-UHFFFAOYSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | 2-amino-3-(2,3-dimethylphenyl)propanoic acid |
| InChIKey | YOOQLMVNYYJZEI-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)CC(C(=O)O)N)C |
Computed by PubChem (NCBI)