Products 10387-24-3

CAS 10387-24-3 is the registry number for Butyl-p-tolylamine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.

Structural formula: {0} (CAS {1})

N-butyl-4-methylaniline (CAS 10387-24-3) is a chemical compound with the molecular formula C11H17N and a molecular weight of 163.26 g/mol. IUPAC name: N-butyl-4-methylaniline. InChIKey: FPHFMZTUFVNDQL-UHFFFAOYSA-N.

Identity
Molecular formulaC11H17N
Molecular weight163.26 g/mol
IUPAC nameN-butyl-4-methylaniline
InChIKeyFPHFMZTUFVNDQL-UHFFFAOYSA-N
SMILESCCCCNC1=CC=C(C=C1)C

Computed by PubChem (NCBI)