CAS 1038724-69-4 appears in our catalog under these names: 1-(2,5-Difluorophenyl)-2,2-difluoroethan-1-amine, 95%, 1-(2,5-Difluorophenyl)-2,2-difluoroethan-1-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(2,5-difluorophenyl)-2,2-difluoroethanamine (CAS 1038724-69-4) is a chemical compound with the molecular formula C8H7F4N and a molecular weight of 193.14 g/mol. IUPAC name: 1-(2,5-difluorophenyl)-2,2-difluoroethanamine. InChIKey: KEZCRGUNLBJCLU-UHFFFAOYSA-N.
| Molecular formula | C8H7F4N |
|---|---|
| Molecular weight | 193.14 g/mol |
| IUPAC name | 1-(2,5-difluorophenyl)-2,2-difluoroethanamine |
| InChIKey | KEZCRGUNLBJCLU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C(C(F)F)N)F |
Computed by PubChem (NCBI)