CAS 1038729-21-3 is the registry number for 5-(2,4-Dimethylphenyl)thiophene-2-carboxylic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
5-(2,4-dimethylphenyl)thiophene-2-carboxylic acid (CAS 1038729-21-3) is a chemical compound with the molecular formula C13H12O2S and a molecular weight of 232.30 g/mol. IUPAC name: 5-(2,4-dimethylphenyl)thiophene-2-carboxylic acid. InChIKey: DPTMNNPYLZJREA-UHFFFAOYSA-N.
| Molecular formula | C13H12O2S |
|---|---|
| Molecular weight | 232.30 g/mol |
| IUPAC name | 5-(2,4-dimethylphenyl)thiophene-2-carboxylic acid |
| InChIKey | DPTMNNPYLZJREA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C2=CC=C(S2)C(=O)O)C |
Computed by PubChem (NCBI)