Products 1038729-21-3

CAS 1038729-21-3 is the registry number for 5-(2,4-Dimethylphenyl)thiophene-2-carboxylic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

5-(2,4-dimethylphenyl)thiophene-2-carboxylic acid (CAS 1038729-21-3) is a chemical compound with the molecular formula C13H12O2S and a molecular weight of 232.30 g/mol. IUPAC name: 5-(2,4-dimethylphenyl)thiophene-2-carboxylic acid. InChIKey: DPTMNNPYLZJREA-UHFFFAOYSA-N.

Identity
Molecular formulaC13H12O2S
Molecular weight232.30 g/mol
IUPAC name5-(2,4-dimethylphenyl)thiophene-2-carboxylic acid
InChIKeyDPTMNNPYLZJREA-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)C2=CC=C(S2)C(=O)O)C

Computed by PubChem (NCBI)