CAS 60301-04-4 appears in our catalog under these names: (R)-O-Anisyl phenyl sulfoxide, 95%, (R)-1-Methoxy-2-(phenylsulfinyl)benzene, 97%, +)–S–o–Anisyl S–phenyl sulphoxid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 250mg, 5g.
1-methoxy-2-[(R)-phenylsulfinyl]benzene (CAS 60301-04-4) is a chemical compound with the molecular formula C13H12O2S and a molecular weight of 232.30 g/mol. IUPAC name: 1-methoxy-2-[(R)-phenylsulfinyl]benzene. InChIKey: FOYIPSPJAHHQKW-MRXNPFEDSA-N.
| Molecular formula | C13H12O2S |
|---|---|
| Molecular weight | 232.30 g/mol |
| IUPAC name | 1-methoxy-2-[(R)-phenylsulfinyl]benzene |
| InChIKey | FOYIPSPJAHHQKW-MRXNPFEDSA-N |
| SMILES | COC1=CC=CC=C1[S@](=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)