CAS 1349716-40-0 is the registry number for 1-(5-(3-(Hydroxymethyl)phenyl)thiophen-2-yl)ethanone, 97%. Offered by: AmBeed. Available pack sizes: 1g.
1-[5-[3-(hydroxymethyl)phenyl]thiophen-2-yl]ethanone (CAS 1349716-40-0) is a chemical compound with the molecular formula C13H12O2S and a molecular weight of 232.30 g/mol. IUPAC name: 1-[5-[3-(hydroxymethyl)phenyl]thiophen-2-yl]ethanone. InChIKey: GGBHMVVIFXYYAY-UHFFFAOYSA-N.
| Molecular formula | C13H12O2S |
|---|---|
| Molecular weight | 232.30 g/mol |
| IUPAC name | 1-[5-[3-(hydroxymethyl)phenyl]thiophen-2-yl]ethanone |
| InChIKey | GGBHMVVIFXYYAY-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(S1)C2=CC=CC(=C2)CO |
Computed by PubChem (NCBI)