CAS 103877-20-9 appears in our catalog under these names: Ozenoxacin Impurity 5, 7-Chloro-1-cyclopropyl-1,4-dihydro-8-methyl-4-oxo-3-quinolinecarboxylic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
7-chloro-1-cyclopropyl-8-methyl-4-oxoquinoline-3-carboxylic acid (CAS 103877-20-9) is a chemical compound with the molecular formula C14H12ClNO3 and a molecular weight of 277.70 g/mol. IUPAC name: 7-chloro-1-cyclopropyl-8-methyl-4-oxoquinoline-3-carboxylic acid. InChIKey: LFBYOJZNJRIKFT-UHFFFAOYSA-N.
| Molecular formula | C14H12ClNO3 |
|---|---|
| Molecular weight | 277.70 g/mol |
| IUPAC name | 7-chloro-1-cyclopropyl-8-methyl-4-oxoquinoline-3-carboxylic acid |
| InChIKey | LFBYOJZNJRIKFT-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1N(C=C(C2=O)C(=O)O)C3CC3)Cl |
Computed by PubChem (NCBI)