CAS 428495-29-8 appears in our catalog under these names: 2-Chloro-5-(3-formyl-2,5-dimethyl-1h-pyrrol-1-yl)benzoic acid, 95%, 2-Chloro-5-(3-formyl-2,5-dimethyl-1H-pyrrol-1-yl)benzoic acid, 98%, 2-Chloro-5-(3-formyl-2,5-dimethyl-1H-pyrrol-1-yl)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
2-chloro-5-(3-formyl-2,5-dimethylpyrrol-1-yl)benzoic acid (CAS 428495-29-8) is a chemical compound with the molecular formula C14H12ClNO3 and a molecular weight of 277.70 g/mol. IUPAC name: 2-chloro-5-(3-formyl-2,5-dimethylpyrrol-1-yl)benzoic acid. InChIKey: SHUWDTVLRJIUBG-UHFFFAOYSA-N.
| Molecular formula | C14H12ClNO3 |
|---|---|
| Molecular weight | 277.70 g/mol |
| IUPAC name | 2-chloro-5-(3-formyl-2,5-dimethylpyrrol-1-yl)benzoic acid |
| InChIKey | SHUWDTVLRJIUBG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1C2=CC(=C(C=C2)Cl)C(=O)O)C)C=O |
Computed by PubChem (NCBI)