Products 2782813-27-6
CAS 2782813-27-6 appears in our catalog under these names: 4-(5-Chloro-2-methoxyphenyl)-6-methylnicotinic acid, 98%, 4-(5-Chloro-2-methoxyphenyl)-6-methylnicotinic acid, 97%, 97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 500mg, 1g, 5g, 10g.
4-(5-chloro-2-methoxyphenyl)-6-methylpyridine-3-carboxylic acid (CAS 2782813-27-6) is a chemical compound with the molecular formula C14H12ClNO3 and a molecular weight of 277.70 g/mol. IUPAC name: 4-(5-chloro-2-methoxyphenyl)-6-methylpyridine-3-carboxylic acid. InChIKey: YTORVSMPIABLLJ-UHFFFAOYSA-N.
| Molecular formula | C14H12ClNO3 |
|---|---|
| Molecular weight | 277.70 g/mol |
| IUPAC name | 4-(5-chloro-2-methoxyphenyl)-6-methylpyridine-3-carboxylic acid |
| InChIKey | YTORVSMPIABLLJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=N1)C(=O)O)C2=C(C=CC(=C2)Cl)OC |
Computed by PubChem (NCBI)