CAS 103882-09-3 appears in our catalog under these names: Boc-p-iodo-dl-phe-oh, 95%, Boc-DL-Phe(4-I)-OH, 98%, Boc–p–iodo–DL–Phe–OH. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 1g, 25g.
3-(4-iodophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 103882-09-3) is a chemical compound with the molecular formula C14H18INO4 and a molecular weight of 391.20 g/mol. IUPAC name: 3-(4-iodophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: JZLZDBGQWRBTHN-UHFFFAOYSA-N.
| Molecular formula | C14H18INO4 |
|---|---|
| Molecular weight | 391.20 g/mol |
| IUPAC name | 3-(4-iodophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | JZLZDBGQWRBTHN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC1=CC=C(C=C1)I)C(=O)O |
Computed by PubChem (NCBI)