CAS 478183-66-3 appears in our catalog under these names: Boc-D-Phe(3-I)-OH, Boc-3-iodo-D-Phenylalanine, 95%, Boc-d-phe(3-i)-oh, 95%, Boc-D-Phe(3-I)-OH, 98%, Boc-d-phe(3-i)-oh, 95%, 95%. Offered by: Iris Biotech, Fluorochem, Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg.
(2R)-3-(3-iodophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 478183-66-3) is a chemical compound with the molecular formula C14H18INO4 and a molecular weight of 391.20 g/mol. IUPAC name: (2R)-3-(3-iodophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: MPTBEGFNTNOLNZ-LLVKDONJSA-N.
| Molecular formula | C14H18INO4 |
|---|---|
| Molecular weight | 391.20 g/mol |
| IUPAC name | (2R)-3-(3-iodophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | MPTBEGFNTNOLNZ-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC(=CC=C1)I)C(=O)O |
Computed by PubChem (NCBI)