CAS 273221-75-3 appears in our catalog under these names: (S)-2-((tert-Butoxycarbonyl)amino)-3-(3-iodophenyl)propanoic acid, 95%, Boc–Phe(3–I)–OH, Boc-3-iodo-l-phenylalanine, 98%, Boc-L-Phe(3-I)-OH, Boc-Phe(3-I)-OH, 98%, 98%. Offered by: Fluorochem, GLPBio, Combi-blocks, Iris Biotech, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 25g.
(2S)-3-(3-iodophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 273221-75-3) is a chemical compound with the molecular formula C14H18INO4 and a molecular weight of 391.20 g/mol. IUPAC name: (2S)-3-(3-iodophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: MPTBEGFNTNOLNZ-NSHDSACASA-N.
| Molecular formula | C14H18INO4 |
|---|---|
| Molecular weight | 391.20 g/mol |
| IUPAC name | (2S)-3-(3-iodophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | MPTBEGFNTNOLNZ-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC(=CC=C1)I)C(=O)O |
Computed by PubChem (NCBI)