CAS 1038975-25-5 is the registry number for 1–(2–(Chloromethyl)phenyl)–1H–1,2,4–triazole. Offered by: GLPBio. Available pack sizes: 100mg.
1-[2-(chloromethyl)phenyl]-1,2,4-triazole (CAS 1038975-25-5) is a chemical compound with the molecular formula C9H8ClN3 and a molecular weight of 193.63 g/mol. IUPAC name: 1-[2-(chloromethyl)phenyl]-1,2,4-triazole. InChIKey: BRDPHGWNETYLJG-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3 |
|---|---|
| Molecular weight | 193.63 g/mol |
| IUPAC name | 1-[2-(chloromethyl)phenyl]-1,2,4-triazole |
| InChIKey | BRDPHGWNETYLJG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CCl)N2C=NC=N2 |
Computed by PubChem (NCBI)