Products 1039335-05-1
CAS 1039335-05-1 is the registry number for 2-Cyclopropyl-1,3-benzoxazol-6-amine. Offered by: TRC, Biosynth. Available pack sizes: 1g, 0,05g, 0,01g, 0,1g, 0,25g, 0,5g.
2-cyclopropyl-1,3-benzoxazol-6-amine (CAS 1039335-05-1) is a chemical compound with the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. IUPAC name: 2-cyclopropyl-1,3-benzoxazol-6-amine. InChIKey: ZXHKSGMKRLUKHC-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 2-cyclopropyl-1,3-benzoxazol-6-amine |
| InChIKey | ZXHKSGMKRLUKHC-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NC3=C(O2)C=C(C=C3)N |
Computed by PubChem (NCBI)