CAS 1039760-91-2 is the registry number for Rosolutamide, 99.03%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 1 mg, 10 mg, 5 mg.
3-hydroxy imidacloprid is an imidacloprid. It has a role as a neonicotinoid insectide and a nicotinic acetylcholine receptor agonist.
Source: ChEBI
| Molecular formula | C28H32O6 |
|---|---|
| Molecular weight | 464.5 g/mol |
| IUPAC name | (1E,6E)-4-(cyclobutylmethyl)-1,7-bis(3,4-dimethoxyphenyl)hepta-1,6-diene-3,5-dione |
| InChIKey | PJOSHEDKRPRCAE-QHKWOANTSA-N |
| SMILES | COC1=C(C=C(C=C1)/C=C/C(=O)C(C(=O)/C=C/C2=CC(=C(C=C2)OC)OC)CC3CCC3)OC |
Computed by PubChem (NCBI)