CAS 1039766-69-2 is the registry number for Dimethyl 1-(2-oxopropyl)-1h-1,2,3-triazole-4,5-dicarboxylate, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Dimethyl 1-(2-oxopropyl)triazole-4,5-dicarboxylate (CAS 1039766-69-2) is a chemical compound with the molecular formula C9H11N3O5 and a molecular weight of 241.20 g/mol. IUPAC name: dimethyl 1-(2-oxopropyl)triazole-4,5-dicarboxylate. InChIKey: JJWCJAOAQTWQPQ-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O5 |
|---|---|
| Molecular weight | 241.20 g/mol |
| IUPAC name | dimethyl 1-(2-oxopropyl)triazole-4,5-dicarboxylate |
| InChIKey | JJWCJAOAQTWQPQ-UHFFFAOYSA-N |
| SMILES | CC(=O)CN1C(=C(N=N1)C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)