Products 1039766-69-2

CAS 1039766-69-2 is the registry number for Dimethyl 1-(2-oxopropyl)-1h-1,2,3-triazole-4,5-dicarboxylate, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Dimethyl 1-(2-oxopropyl)triazole-4,5-dicarboxylate (CAS 1039766-69-2) is a chemical compound with the molecular formula C9H11N3O5 and a molecular weight of 241.20 g/mol. IUPAC name: dimethyl 1-(2-oxopropyl)triazole-4,5-dicarboxylate. InChIKey: JJWCJAOAQTWQPQ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11N3O5
Molecular weight241.20 g/mol
IUPAC namedimethyl 1-(2-oxopropyl)triazole-4,5-dicarboxylate
InChIKeyJJWCJAOAQTWQPQ-UHFFFAOYSA-N
SMILESCC(=O)CN1C(=C(N=N1)C(=O)OC)C(=O)OC

Computed by PubChem (NCBI)