CAS 84080-54-6 is the registry number for (2Z)-2-[(2-Ethoxy-2-oxoethoxy)imino]-2-(1h-pyrazol-3-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(2Z)-2-(2-ethoxy-2-oxoethoxy)imino-2-(1H-pyrazol-5-yl)acetic acid (CAS 84080-54-6) is a chemical compound with the molecular formula C9H11N3O5 and a molecular weight of 241.20 g/mol. IUPAC name: (2Z)-2-(2-ethoxy-2-oxoethoxy)imino-2-(1H-pyrazol-5-yl)acetic acid. InChIKey: HWVWHAMUHWPKPD-WQLSENKSSA-N.
| Molecular formula | C9H11N3O5 |
|---|---|
| Molecular weight | 241.20 g/mol |
| IUPAC name | (2Z)-2-(2-ethoxy-2-oxoethoxy)imino-2-(1H-pyrazol-5-yl)acetic acid |
| InChIKey | HWVWHAMUHWPKPD-WQLSENKSSA-N |
| SMILES | CCOC(=O)CO/N=C(/C1=CC=NN1)\C(=O)O |
Computed by PubChem (NCBI)