Products 84080-54-6

CAS 84080-54-6 is the registry number for (2Z)-2-[(2-Ethoxy-2-oxoethoxy)imino]-2-(1h-pyrazol-3-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

(2Z)-2-(2-ethoxy-2-oxoethoxy)imino-2-(1H-pyrazol-5-yl)acetic acid (CAS 84080-54-6) is a chemical compound with the molecular formula C9H11N3O5 and a molecular weight of 241.20 g/mol. IUPAC name: (2Z)-2-(2-ethoxy-2-oxoethoxy)imino-2-(1H-pyrazol-5-yl)acetic acid. InChIKey: HWVWHAMUHWPKPD-WQLSENKSSA-N.

Identity
Molecular formulaC9H11N3O5
Molecular weight241.20 g/mol
IUPAC name(2Z)-2-(2-ethoxy-2-oxoethoxy)imino-2-(1H-pyrazol-5-yl)acetic acid
InChIKeyHWVWHAMUHWPKPD-WQLSENKSSA-N
SMILESCCOC(=O)CO/N=C(/C1=CC=NN1)\C(=O)O

Computed by PubChem (NCBI)