Products 1308677-74-8
CAS 1308677-74-8 appears in our catalog under these names: Uracil Impurity 8, Fluorouracil Impurity 32. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-3-oxopropanoic acid (CAS 1308677-74-8) is a chemical compound with the molecular formula C9H11N3O5 and a molecular weight of 241.20 g/mol. IUPAC name: 3-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-3-oxopropanoic acid. InChIKey: HFXDFVCCKPRECG-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O5 |
|---|---|
| Molecular weight | 241.20 g/mol |
| IUPAC name | 3-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-3-oxopropanoic acid |
| InChIKey | HFXDFVCCKPRECG-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C(=O)N(C1=O)C)C(=O)CC(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
Fluorouracil Impurity 32