Products 103979-29-9

CAS 103979-29-9 is the registry number for (E)-1-Chloro-4-(3-chloroprop-1-en-1-yl)benzene 95% mix TBC as stabilizer. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

1-chloro-4-[(E)-3-chloroprop-1-enyl]benzene (CAS 103979-29-9) is a chemical compound with the molecular formula C9H8Cl2 and a molecular weight of 187.06 g/mol. IUPAC name: 1-chloro-4-[(E)-3-chloroprop-1-enyl]benzene. InChIKey: CLZRDHUBODXICN-OWOJBTEDSA-N.

Identity
Molecular formulaC9H8Cl2
Molecular weight187.06 g/mol
IUPAC name1-chloro-4-[(E)-3-chloroprop-1-enyl]benzene
InChIKeyCLZRDHUBODXICN-OWOJBTEDSA-N
SMILESC1=CC(=CC=C1/C=C/CCl)Cl

Computed by PubChem (NCBI)