CAS 99849-26-0 is the registry number for 1,2-Dichloro-3-(prop-1-en-2-yl)benzene, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1,2-dichloro-3-prop-1-en-2-ylbenzene (CAS 99849-26-0) is a chemical compound with the molecular formula C9H8Cl2 and a molecular weight of 187.06 g/mol. IUPAC name: 1,2-dichloro-3-prop-1-en-2-ylbenzene. InChIKey: RCMGXARQSFXMPO-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2 |
|---|---|
| Molecular weight | 187.06 g/mol |
| IUPAC name | 1,2-dichloro-3-prop-1-en-2-ylbenzene |
| InChIKey | RCMGXARQSFXMPO-UHFFFAOYSA-N |
| SMILES | CC(=C)C1=C(C(=CC=C1)Cl)Cl |
Computed by PubChem (NCBI)