CAS 68575-36-0 appears in our catalog under these names: 2-(3,5-Dichlorophenyl)propene, 95%, 2-(3,5-Dichlorophenyl)propene. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 1g, 5g.
1,3-dichloro-5-prop-1-en-2-ylbenzene (CAS 68575-36-0) is a chemical compound with the molecular formula C9H8Cl2 and a molecular weight of 187.06 g/mol. IUPAC name: 1,3-dichloro-5-prop-1-en-2-ylbenzene. InChIKey: CSXMJJOTTRDXHY-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2 |
|---|---|
| Molecular weight | 187.06 g/mol |
| IUPAC name | 1,3-dichloro-5-prop-1-en-2-ylbenzene |
| InChIKey | CSXMJJOTTRDXHY-UHFFFAOYSA-N |
| SMILES | CC(=C)C1=CC(=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)