Products 1039885-47-6

CAS 1039885-47-6 is the registry number for 4-(Cyanomethoxy)-3,5-dimethylbenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-(cyanomethoxy)-3,5-dimethylbenzoic acid (CAS 1039885-47-6) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: 4-(cyanomethoxy)-3,5-dimethylbenzoic acid. InChIKey: FZMVZDOLSXNGEL-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11NO3
Molecular weight205.21 g/mol
IUPAC name4-(cyanomethoxy)-3,5-dimethylbenzoic acid
InChIKeyFZMVZDOLSXNGEL-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1OCC#N)C)C(=O)O

Computed by PubChem (NCBI)