Products 1822931-95-2

CAS 1822931-95-2 is the registry number for 5-Chloro-6-hydroxypicolinic acid 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

5-chloro-6-oxo-1H-pyridine-2-carboxylic acid (CAS 1822931-95-2) is a chemical compound with the molecular formula C6H4ClNO3 and a molecular weight of 173.55 g/mol. IUPAC name: 5-chloro-6-oxo-1H-pyridine-2-carboxylic acid. InChIKey: GJCDETCQSYSYFT-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4ClNO3
Molecular weight173.55 g/mol
IUPAC name5-chloro-6-oxo-1H-pyridine-2-carboxylic acid
InChIKeyGJCDETCQSYSYFT-UHFFFAOYSA-N
SMILESC1=C(C(=O)NC(=C1)C(=O)O)Cl

Computed by PubChem (NCBI)