Products 1040006-05-0
CAS 1040006-05-0 is the registry number for 5-Chloro-6-((5-fluoro-2-methylphenyl)amino)pyridine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
5-chloro-6-(5-fluoro-2-methylanilino)pyridine-3-carboxylic acid (CAS 1040006-05-0) is a chemical compound with the molecular formula C13H10ClFN2O2 and a molecular weight of 280.68 g/mol. IUPAC name: 5-chloro-6-(5-fluoro-2-methylanilino)pyridine-3-carboxylic acid. InChIKey: LKGFSRBHSJEVSZ-UHFFFAOYSA-N.
| Molecular formula | C13H10ClFN2O2 |
|---|---|
| Molecular weight | 280.68 g/mol |
| IUPAC name | 5-chloro-6-(5-fluoro-2-methylanilino)pyridine-3-carboxylic acid |
| InChIKey | LKGFSRBHSJEVSZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)F)NC2=C(C=C(C=N2)C(=O)O)Cl |
Computed by PubChem (NCBI)