CAS 1152536-23-6 is the registry number for 1-(4-Chloro-2-fluorophenyl)-1H,4H,5H,6H-cyclopenta(C)pyrazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(4-chloro-2-fluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylic acid (CAS 1152536-23-6) is a chemical compound with the molecular formula C13H10ClFN2O2 and a molecular weight of 280.68 g/mol. IUPAC name: 1-(4-chloro-2-fluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylic acid. InChIKey: AALLNSDDKGMNKD-UHFFFAOYSA-N.
| Molecular formula | C13H10ClFN2O2 |
|---|---|
| Molecular weight | 280.68 g/mol |
| IUPAC name | 1-(4-chloro-2-fluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylic acid |
| InChIKey | AALLNSDDKGMNKD-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)N(N=C2C(=O)O)C3=C(C=C(C=C3)Cl)F |
Computed by PubChem (NCBI)