CAS 2879233-87-9 is the registry number for Benzyl (2-chloro-5-fluoropyridin-4-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl N-(2-chloro-5-fluoro-4-pyridinyl)carbamate (CAS 2879233-87-9) is a chemical compound with the molecular formula C13H10ClFN2O2 and a molecular weight of 280.68 g/mol. IUPAC name: benzyl N-(2-chloro-5-fluoro-4-pyridinyl)carbamate. InChIKey: PHKMZUZKEINRAZ-UHFFFAOYSA-N.
| Molecular formula | C13H10ClFN2O2 |
|---|---|
| Molecular weight | 280.68 g/mol |
| IUPAC name | benzyl N-(2-chloro-5-fluoro-4-pyridinyl)carbamate |
| InChIKey | PHKMZUZKEINRAZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC2=CC(=NC=C2F)Cl |
Computed by PubChem (NCBI)