CAS 1040011-54-8 is the registry number for 4-{((3,5-Dichloro-2-hydroxyphenyl)methyl)amino}benzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-[(3,5-dichloro-2-hydroxyphenyl)methylamino]benzenesulfonamide (CAS 1040011-54-8) is a chemical compound with the molecular formula C13H12Cl2N2O3S and a molecular weight of 347.2 g/mol. IUPAC name: 4-[(3,5-dichloro-2-hydroxyphenyl)methylamino]benzenesulfonamide. InChIKey: LQYZOJLODAHKHF-UHFFFAOYSA-N.
| Molecular formula | C13H12Cl2N2O3S |
|---|---|
| Molecular weight | 347.2 g/mol |
| IUPAC name | 4-[(3,5-dichloro-2-hydroxyphenyl)methylamino]benzenesulfonamide |
| InChIKey | LQYZOJLODAHKHF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NCC2=C(C(=CC(=C2)Cl)Cl)O)S(=O)(=O)N |
Computed by PubChem (NCBI)