Products 2719842-14-3
CAS 2719842-14-3 is the registry number for Antibacterial agent 31. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(E)-2-(2,4-dichlorophenyl)ethenyl]-5-propan-2-ylsulfonyl-1,3,4-oxadiazole (CAS 2719842-14-3) is a chemical compound with the molecular formula C13H12Cl2N2O3S and a molecular weight of 347.2 g/mol. IUPAC name: 2-[(E)-2-(2,4-dichlorophenyl)ethenyl]-5-propan-2-ylsulfonyl-1,3,4-oxadiazole. InChIKey: CLHYIHRJYYAGJJ-GQCTYLIASA-N.
| Molecular formula | C13H12Cl2N2O3S |
|---|---|
| Molecular weight | 347.2 g/mol |
| IUPAC name | 2-[(E)-2-(2,4-dichlorophenyl)ethenyl]-5-propan-2-ylsulfonyl-1,3,4-oxadiazole |
| InChIKey | CLHYIHRJYYAGJJ-GQCTYLIASA-N |
| SMILES | CC(C)S(=O)(=O)C1=NN=C(O1)/C=C/C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)