CAS 1094926-46-1 is the registry number for 4-Amino-N-(2,4-dichlorophenyl)-2-methoxybenzene-1-sulfonamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-amino-N-(2,4-dichlorophenyl)-2-methoxybenzenesulfonamide (CAS 1094926-46-1) is a chemical compound with the molecular formula C13H12Cl2N2O3S and a molecular weight of 347.2 g/mol. IUPAC name: 4-amino-N-(2,4-dichlorophenyl)-2-methoxybenzenesulfonamide. InChIKey: HYMWMULHSYEATR-UHFFFAOYSA-N.
| Molecular formula | C13H12Cl2N2O3S |
|---|---|
| Molecular weight | 347.2 g/mol |
| IUPAC name | 4-amino-N-(2,4-dichlorophenyl)-2-methoxybenzenesulfonamide |
| InChIKey | HYMWMULHSYEATR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)N)S(=O)(=O)NC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)