Products 1040057-12-2

CAS 1040057-12-2 is the registry number for 2-((4-Iodophenyl)amino)pyridine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-(4-iodoanilino)pyridine-3-carboxylic acid (CAS 1040057-12-2) is a chemical compound with the molecular formula C12H9IN2O2 and a molecular weight of 340.12 g/mol. IUPAC name: 2-(4-iodoanilino)pyridine-3-carboxylic acid. InChIKey: YVCSGCCOQHVDML-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9IN2O2
Molecular weight340.12 g/mol
IUPAC name2-(4-iodoanilino)pyridine-3-carboxylic acid
InChIKeyYVCSGCCOQHVDML-UHFFFAOYSA-N
SMILESC1=CC(=C(N=C1)NC2=CC=C(C=C2)I)C(=O)O

Computed by PubChem (NCBI)