CAS 930073-23-7 is the registry number for N-(3-Iodophenyl)-6-oxo-1,6-dihydropyridine-3-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(3-iodophenyl)-6-oxo-1H-pyridine-3-carboxamide (CAS 930073-23-7) is a chemical compound with the molecular formula C12H9IN2O2 and a molecular weight of 340.12 g/mol. IUPAC name: N-(3-iodophenyl)-6-oxo-1H-pyridine-3-carboxamide. InChIKey: QCQAHTADKIMUMK-UHFFFAOYSA-N.
| Molecular formula | C12H9IN2O2 |
|---|---|
| Molecular weight | 340.12 g/mol |
| IUPAC name | N-(3-iodophenyl)-6-oxo-1H-pyridine-3-carboxamide |
| InChIKey | QCQAHTADKIMUMK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)I)NC(=O)C2=CNC(=O)C=C2 |
Computed by PubChem (NCBI)