CAS 852176-99-9 is the registry number for N-(2-Iodophenyl)-6-oxo-1,6-dihydropyridine-3-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2-iodophenyl)-6-oxo-1H-pyridine-3-carboxamide (CAS 852176-99-9) is a chemical compound with the molecular formula C12H9IN2O2 and a molecular weight of 340.12 g/mol. IUPAC name: N-(2-iodophenyl)-6-oxo-1H-pyridine-3-carboxamide. InChIKey: WELKZIMTFNICDQ-UHFFFAOYSA-N.
| Molecular formula | C12H9IN2O2 |
|---|---|
| Molecular weight | 340.12 g/mol |
| IUPAC name | N-(2-iodophenyl)-6-oxo-1H-pyridine-3-carboxamide |
| InChIKey | WELKZIMTFNICDQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC(=O)C2=CNC(=O)C=C2)I |
Computed by PubChem (NCBI)