CAS 104036-77-3 is the registry number for 7-Chlorophenothiazin-3-ol. Offered by: TRC. Available pack sizes: 1g.
7-chloro-10H-phenothiazin-3-ol (CAS 104036-77-3) is a chemical compound with the molecular formula C12H8ClNOS and a molecular weight of 249.72 g/mol. IUPAC name: 7-chloro-10H-phenothiazin-3-ol. InChIKey: XYVIDWXYLWNTJA-UHFFFAOYSA-N.
| Molecular formula | C12H8ClNOS |
|---|---|
| Molecular weight | 249.72 g/mol |
| IUPAC name | 7-chloro-10H-phenothiazin-3-ol |
| InChIKey | XYVIDWXYLWNTJA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)SC3=C(N2)C=CC(=C3)Cl |
Computed by PubChem (NCBI)