CAS 2002-32-6 appears in our catalog under these names: 8-Chloro-10H-phenothiazin-3-ol, 97%, 2-Chloro-7-hydroxy Phenothiazine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg, 500mg, 50mg.
8-chloro-10H-phenothiazin-3-ol (CAS 2002-32-6) is a chemical compound with the molecular formula C12H8ClNOS and a molecular weight of 249.72 g/mol. IUPAC name: 8-chloro-10H-phenothiazin-3-ol. InChIKey: CIAFBHJSFCQEBJ-UHFFFAOYSA-N.
| Molecular formula | C12H8ClNOS |
|---|---|
| Molecular weight | 249.72 g/mol |
| IUPAC name | 8-chloro-10H-phenothiazin-3-ol |
| InChIKey | CIAFBHJSFCQEBJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)SC3=C(N2)C=C(C=C3)Cl |
Computed by PubChem (NCBI)