Products 1927-43-1
CAS 1927-43-1 is the registry number for Perphenazine Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-10H-phenothiazine 5-oxide (CAS 1927-43-1) is a chemical compound with the molecular formula C12H8ClNOS and a molecular weight of 249.72 g/mol. IUPAC name: 2-chloro-10H-phenothiazine 5-oxide. InChIKey: HFIIJPQBZFAIHU-UHFFFAOYSA-N.
| Molecular formula | C12H8ClNOS |
|---|---|
| Molecular weight | 249.72 g/mol |
| IUPAC name | 2-chloro-10H-phenothiazine 5-oxide |
| InChIKey | HFIIJPQBZFAIHU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC3=C(S2=O)C=CC(=C3)Cl |
Computed by PubChem (NCBI)
Synonyms:
2-chloro-10H-phenothiazine 5-oxide, 2-Chlorophenothiazine sulfoxide, 10H-Phenothiazine, 2-chloro-, S-oxide, 2-chlorophenothiazone, Perphenazine Impurity 4, 2-chloro-phenothiazine-5-oxide, HFIIJPQBZFAIHU-UHFFFAOYSA-N, Phenothiazine, 2-chloro-, 5-oxide, 10H-Phenothiazine, 2-chloro-, 5-oxide, 2-Chloro-5lambda~4~-phenothiazin-5(10H)-one