Products 1040706-91-9

CAS 1040706-91-9 is the registry number for NPD10084, 99.69%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 5 mg, 50 mg, 10mM/1mL, 100 mg, 10 mg.

Structural formula: {0} (CAS {1})

(4-methoxy-1H-indol-2-yl)-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone (CAS 1040706-91-9) is a chemical compound with the molecular formula C21H19N3O2 and a molecular weight of 345.4 g/mol. IUPAC name: (4-methoxy-1H-indol-2-yl)-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone. InChIKey: NKLSWHYOKYAGED-UHFFFAOYSA-N.

Identity
Molecular formulaC21H19N3O2
Molecular weight345.4 g/mol
IUPAC name(4-methoxy-1H-indol-2-yl)-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone
InChIKeyNKLSWHYOKYAGED-UHFFFAOYSA-N
SMILESCOC1=CC=CC2=C1C=C(N2)C(=O)N3CCC4=C(C3)C5=CC=CC=C5N4

Computed by PubChem (NCBI)