Products 1256264-62-6
CAS 1256264-62-6 is the registry number for PF-4950834, 99.60%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg, 5 mg.
N-methyl-3-[[(4-pyridin-4-ylbenzoyl)amino]methyl]benzamide (CAS 1256264-62-6) is a chemical compound with the molecular formula C21H19N3O2 and a molecular weight of 345.4 g/mol. IUPAC name: N-methyl-3-[[(4-pyridin-4-ylbenzoyl)amino]methyl]benzamide. InChIKey: RDEQMEOWUFYGDZ-UHFFFAOYSA-N.
| Molecular formula | C21H19N3O2 |
|---|---|
| Molecular weight | 345.4 g/mol |
| IUPAC name | N-methyl-3-[[(4-pyridin-4-ylbenzoyl)amino]methyl]benzamide |
| InChIKey | RDEQMEOWUFYGDZ-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC=CC(=C1)CNC(=O)C2=CC=C(C=C2)C3=CC=NC=C3 |
Computed by PubChem (NCBI)