CAS 300837-31-4 is the registry number for 4-((5-Allyl-6-methyl-2-phenyl-4-pyrimidinyl)amino)benzoic acid. Offered by: Biosynth. Available pack sizes: 1000mg, 5000mg.
4-[(6-methyl-2-phenyl-5-prop-2-enylpyrimidin-4-yl)amino]benzoic acid (CAS 300837-31-4) is a chemical compound with the molecular formula C21H19N3O2 and a molecular weight of 345.4 g/mol. IUPAC name: 4-[(6-methyl-2-phenyl-5-prop-2-enylpyrimidin-4-yl)amino]benzoic acid. InChIKey: SQYRBODOBCAROZ-UHFFFAOYSA-N.
| Molecular formula | C21H19N3O2 |
|---|---|
| Molecular weight | 345.4 g/mol |
| IUPAC name | 4-[(6-methyl-2-phenyl-5-prop-2-enylpyrimidin-4-yl)amino]benzoic acid |
| InChIKey | SQYRBODOBCAROZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC(=N1)C2=CC=CC=C2)NC3=CC=C(C=C3)C(=O)O)CC=C |
Computed by PubChem (NCBI)