CAS 1040922-73-3 is the registry number for 5,5-dimethyl-2-(3-thienyl)-1,3-thiazolidine-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 500mg.
5,5-dimethyl-2-thiophen-3-yl-1,3-thiazolidine-4-carboxylic acid (CAS 1040922-73-3) is a chemical compound with the molecular formula C10H13NO2S2 and a molecular weight of 243.4 g/mol. IUPAC name: 5,5-dimethyl-2-thiophen-3-yl-1,3-thiazolidine-4-carboxylic acid. InChIKey: QOMMCXODIHCENQ-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2S2 |
|---|---|
| Molecular weight | 243.4 g/mol |
| IUPAC name | 5,5-dimethyl-2-thiophen-3-yl-1,3-thiazolidine-4-carboxylic acid |
| InChIKey | QOMMCXODIHCENQ-UHFFFAOYSA-N |
| SMILES | CC1(C(NC(S1)C2=CSC=C2)C(=O)O)C |
Computed by PubChem (NCBI)