Products 173281-01-1

CAS 173281-01-1 is the registry number for 2-Amino-4,7-dihydro-5h-thieno[2,3-c]thiopyran-3-carboxylic acid ethyl ester, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Ethyl 2-amino-5,7-dihydro-4H-thieno[2,3-c]thiopyran-3-carboxylate (CAS 173281-01-1) is a chemical compound with the molecular formula C10H13NO2S2 and a molecular weight of 243.4 g/mol. IUPAC name: ethyl 2-amino-5,7-dihydro-4H-thieno[2,3-c]thiopyran-3-carboxylate. InChIKey: BUBJJJMGHWCARG-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13NO2S2
Molecular weight243.4 g/mol
IUPAC nameethyl 2-amino-5,7-dihydro-4H-thieno[2,3-c]thiopyran-3-carboxylate
InChIKeyBUBJJJMGHWCARG-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(SC2=C1CCSC2)N

Computed by PubChem (NCBI)