Products 1543487-30-4

CAS 1543487-30-4 is the registry number for 4-(Thiophen-3-ylmethyl)thiomorpholine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-(thiophen-3-ylmethyl)thiomorpholine-3-carboxylic acid (CAS 1543487-30-4) is a chemical compound with the molecular formula C10H13NO2S2 and a molecular weight of 243.4 g/mol. IUPAC name: 4-(thiophen-3-ylmethyl)thiomorpholine-3-carboxylic acid. InChIKey: LSBCGMZMIDKHPD-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13NO2S2
Molecular weight243.4 g/mol
IUPAC name4-(thiophen-3-ylmethyl)thiomorpholine-3-carboxylic acid
InChIKeyLSBCGMZMIDKHPD-UHFFFAOYSA-N
SMILESC1CSCC(N1CC2=CSC=C2)C(=O)O

Computed by PubChem (NCBI)