Products 104097-59-8
CAS 104097-59-8 appears in our catalog under these names: Mequindox Impurity 4, Mequindox Impurity 5, alpha,3-Dimethyl-2-quinoxalinemethanol 1,4-Dioxide, 2-Isoethanol-Mequindox, 2-Isoethanol-Mequindox, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Chemat Brand, TRC, HPC Standards. Available pack sizes: on request, 250mg, 1x10mg, 1x1ml.
1-(3-methyl-4-oxido-1-oxoquinoxalin-1-ium-2-yl)ethanol (CAS 104097-59-8) is a chemical compound with the molecular formula C11H12N2O3 and a molecular weight of 220.22 g/mol. IUPAC name: 1-(3-methyl-4-oxido-1-oxoquinoxalin-1-ium-2-yl)ethanol. InChIKey: PGVFUFKBBBHTNR-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O3 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | 1-(3-methyl-4-oxido-1-oxoquinoxalin-1-ium-2-yl)ethanol |
| InChIKey | PGVFUFKBBBHTNR-UHFFFAOYSA-N |
| SMILES | CC1=C([N+](=O)C2=CC=CC=C2N1[O-])C(C)O |
Computed by PubChem (NCBI)