CAS 1041026-64-5 appears in our catalog under these names: 2–Benzyl–6–tosyl–2,6–diazaspiro(3·3)heptane, 2-Benzyl-6-tosyl-2,6-diazaspiro[3.3]heptane, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 100mg, 5g.
6-benzyl-2-(4-methylphenyl)sulfonyl-2,6-diazaspiro[3.3]heptane (CAS 1041026-64-5) is a chemical compound with the molecular formula C19H22N2O2S and a molecular weight of 342.5 g/mol. IUPAC name: 6-benzyl-2-(4-methylphenyl)sulfonyl-2,6-diazaspiro[3.3]heptane. InChIKey: ZACIGTDVMNBTDK-UHFFFAOYSA-N.
| Molecular formula | C19H22N2O2S |
|---|---|
| Molecular weight | 342.5 g/mol |
| IUPAC name | 6-benzyl-2-(4-methylphenyl)sulfonyl-2,6-diazaspiro[3.3]heptane |
| InChIKey | ZACIGTDVMNBTDK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CC3(C2)CN(C3)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)