Products 1223573-36-1
CAS 1223573-36-1 is the registry number for 1-benzyl-6-tosyl-1,6-diazaspiro[3.3]heptane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 500mg.
1-benzyl-6-(4-methylphenyl)sulfonyl-1,6-diazaspiro[3.3]heptane (CAS 1223573-36-1) is a chemical compound with the molecular formula C19H22N2O2S and a molecular weight of 342.5 g/mol. IUPAC name: 1-benzyl-6-(4-methylphenyl)sulfonyl-1,6-diazaspiro[3.3]heptane. InChIKey: JSUSYNCRRVARDK-UHFFFAOYSA-N.
| Molecular formula | C19H22N2O2S |
|---|---|
| Molecular weight | 342.5 g/mol |
| IUPAC name | 1-benzyl-6-(4-methylphenyl)sulfonyl-1,6-diazaspiro[3.3]heptane |
| InChIKey | JSUSYNCRRVARDK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CC3(C2)CCN3CC4=CC=CC=C4 |
Computed by PubChem (NCBI)