Products 120823-40-7
CAS 120823-40-7 is the registry number for (2-indol-3-ylethyl)((2,4,6-trimethylphenyl)sulfonyl)amine. Offered by: Biosynth. Available pack sizes: 250mg.
N-[2-(1H-indol-3-yl)ethyl]-2,4,6-trimethylbenzenesulfonamide (CAS 120823-40-7) is a chemical compound with the molecular formula C19H22N2O2S and a molecular weight of 342.5 g/mol. IUPAC name: N-[2-(1H-indol-3-yl)ethyl]-2,4,6-trimethylbenzenesulfonamide. InChIKey: YCBIVZFUZONPAN-UHFFFAOYSA-N.
| Molecular formula | C19H22N2O2S |
|---|---|
| Molecular weight | 342.5 g/mol |
| IUPAC name | N-[2-(1H-indol-3-yl)ethyl]-2,4,6-trimethylbenzenesulfonamide |
| InChIKey | YCBIVZFUZONPAN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)S(=O)(=O)NCCC2=CNC3=CC=CC=C32)C |
Computed by PubChem (NCBI)