Products 104112-82-5
CAS 104112-82-5 appears in our catalog under these names: Phellodendrine chloride, Phellodendrine Chloride, >95% (HPLC), Phellodendrine chloride/ 99.05% (existing batch purity), Phellodendrine Hydrochloride, 98%, 98%, Phellodendrine (chloride) (Standard). Offered by: GLPBio, TRC, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 100mg, 10mg, 20mg, 2mg, 25mg, 50mg, 250mg.
(13aS)-3,10-dimethoxy-7-methyl-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-7-ium-2,11-diol chloride (CAS 104112-82-5) is a chemical compound with the molecular formula C20H24ClNO4 and a molecular weight of 377.9 g/mol. IUPAC name: (13aS)-3,10-dimethoxy-7-methyl-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-7-ium-2,11-diol chloride. InChIKey: DGLDSNPMIYUWGN-OOJQBDKLSA-N.
| Molecular formula | C20H24ClNO4 |
|---|---|
| Molecular weight | 377.9 g/mol |
| IUPAC name | (13aS)-3,10-dimethoxy-7-methyl-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-7-ium-2,11-diol chloride |
| InChIKey | DGLDSNPMIYUWGN-OOJQBDKLSA-N |
| SMILES | C[N+]12CCC3=CC(=C(C=C3[C@@H]1CC4=CC(=C(C=C4C2)OC)O)O)OC.[Cl-] |
Computed by PubChem (NCBI)