Products 127017-74-7
CAS 127017-74-7 appears in our catalog under these names: Paroxetine USP RC A,Paroxetine Hydrochloride Hemihydrate EP Impurity B, Paroxetine HCl Hemihydrate EP Impurity B HCl, rel-(3R,4S)-3-((Benzo[d][1,3]dioxol-5-yloxy)methyl)-4-(4-methoxyphenyl)piperidine hydrochloride, 98%, Paroxetine Impurity 15（Paroxetine HCl Hemihydrate EP Impurity B）, rac-trans-4-Defluoro-4-methoxy Paroxetine Hydrochloride, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(3S,4R)-3-(1,3-benzodioxol-5-yloxymethyl)-4-(4-methoxyphenyl)piperidine;hydrochloride (CAS 127017-74-7) is a chemical compound with the molecular formula C20H24ClNO4 and a molecular weight of 377.9 g/mol. IUPAC name: (3S,4R)-3-(1,3-benzodioxol-5-yloxymethyl)-4-(4-methoxyphenyl)piperidine;hydrochloride. InChIKey: WGRXGIJCIOCNHB-NKGQWRHHSA-N.
| Molecular formula | C20H24ClNO4 |
|---|---|
| Molecular weight | 377.9 g/mol |
| IUPAC name | (3S,4R)-3-(1,3-benzodioxol-5-yloxymethyl)-4-(4-methoxyphenyl)piperidine;hydrochloride |
| InChIKey | WGRXGIJCIOCNHB-NKGQWRHHSA-N |
| SMILES | COC1=CC=C(C=C1)[C@@H]2CCNC[C@H]2COC3=CC4=C(C=C3)OCO4.Cl |
Computed by PubChem (NCBI)
Synonyms:
rac-trans-4-Defluoro-4-methoxy Paroxetine Hydrochloride, trans-3S-Defluoro-4-methoxy Paroxetine Hydrochloride, Paroxetine Hydrochloride Hemihydrate EP Impurity B, 127017-69-0(free base), Paroxetine Hemihydrate EP Impurity B HCl, Paroxetine USP Rc A; Paroxetine Hydrochloride Hemihydrate EP Impurity B