Products 13552-72-2
CAS 13552-72-2 appears in our catalog under these names: (+)-Isocorydine hydrochloride, 95%, Isocorydine HCl, Isocorydine Hydrochloride, (+)-Isocorydine hydrochloride/ 99.72% (existing batch purity), (+)-Isocorydine hydrochloride. Offered by: Combi-blocks, Chemat Brand, TRC, TargetMol, Chemat. Available pack sizes: 100mg, 250mg, on request, 50mg, 1mg, 2mg, 5mg, 10mg.
(6aS)-1,2,10-trimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-ol;hydrochloride (CAS 13552-72-2) is a chemical compound with the molecular formula C20H24ClNO4 and a molecular weight of 377.9 g/mol. IUPAC name: (6aS)-1,2,10-trimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-ol;hydrochloride. InChIKey: ZWSKLEMBDRWSNZ-ZOWNYOTGSA-N.
| Molecular formula | C20H24ClNO4 |
|---|---|
| Molecular weight | 377.9 g/mol |
| IUPAC name | (6aS)-1,2,10-trimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-ol;hydrochloride |
| InChIKey | ZWSKLEMBDRWSNZ-ZOWNYOTGSA-N |
| SMILES | CN1CCC2=CC(=C(C3=C2[C@@H]1CC4=C3C(=C(C=C4)OC)O)OC)OC.Cl |
Computed by PubChem (NCBI)