CAS 1041205-21-3 appears in our catalog under these names: Methyl 4-bromo-3-ethoxybenzoate, 95%, Methyl 4-bromo-3-ethoxybenzoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
Methyl 4-bromo-3-ethoxybenzoate (CAS 1041205-21-3) is a chemical compound with the molecular formula C10H11BrO3 and a molecular weight of 259.10 g/mol. IUPAC name: methyl 4-bromo-3-ethoxybenzoate. InChIKey: JLGQGWFJXDBERO-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO3 |
|---|---|
| Molecular weight | 259.10 g/mol |
| IUPAC name | methyl 4-bromo-3-ethoxybenzoate |
| InChIKey | JLGQGWFJXDBERO-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1)C(=O)OC)Br |
Computed by PubChem (NCBI)