CAS 104130-36-1 is the registry number for 1,1’-Diphenyl-1,1',2,2',3,3',4,4',5,5',6,6'-13C12, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg, 5mg.
(1,2,3,4,5,6-13C6)cyclohexatrienyl(1,2,3,4,5,6-13C6)cyclohexatriene (CAS 104130-36-1) is a chemical compound with the molecular formula C12H10 and a molecular weight of 166.120 g/mol. IUPAC name: (1,2,3,4,5,6-13C6)cyclohexatrienyl(1,2,3,4,5,6-13C6)cyclohexatriene. InChIKey: ZUOUZKKEUPVFJK-WCGVKTIYSA-N.
| Molecular formula | C12H10 |
|---|---|
| Molecular weight | 166.120 g/mol |
| IUPAC name | (1,2,3,4,5,6-13C6)cyclohexatrienyl(1,2,3,4,5,6-13C6)cyclohexatriene |
| InChIKey | ZUOUZKKEUPVFJK-WCGVKTIYSA-N |
| SMILES | [13CH]1=[13CH][13CH]=[13C]([13CH]=[13CH]1)[13C]2=[13CH][13CH]=[13CH][13CH]=[13CH]2 |
Computed by PubChem (NCBI)